C21H27F3N4O4 — CID 171321840
(3aS,6aS)-4-[(1-methylimidazol-2-yl)methyl]-1-[[4-(trifluoromethyl)phenyl]methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;formic acid (PubChem CID 171321840) has the molecular formula C21H27F3N4O4 and a molecular weight of 456.47 g/mol. Its IUPAC name is (3aS,6aS)-4-[(1-methylimidazol-2-yl)methyl]-1-[[4-(trifluoromethyl)phenyl]methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;formic acid.
| Compound Name | (3aS,6aS)-4-[(1-methylimidazol-2-yl)methyl]-1-[[4-(trifluoromethyl)phenyl]methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;formic acid |
|---|---|
| PubChem CID | 171321840 |
| Molecular Formula | C21H27F3N4O4 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | (3aS,6aS)-4-[(1-methylimidazol-2-yl)methyl]-1-[[4-(trifluoromethyl)phenyl]methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;formic acid |
| SMILES | Cn1ccnc1CN1CC[C@H]2[C@@H]1CCN2Cc1ccc(C(F)(F)F)cc1.O=CO.O=CO |
| InChI | InChI=1S/C19H23F3N4.2CH2O2/c1-24-11-8-23-18(24)13-26-10-7-16-17(26)6-9-25(16)12-14-2-4-15(5-3-14)19(20,21)22;2*2-1-3/h2-5,8,11,16-17H,6-7,9-10,12-13H2,1H3;2*1H,(H,2,3)/t16-,17-;;/m0../s1 |
| InChIKey | TWNVHJOOBHXEHZ-SZKOKKDDSA-N |
| XLogP | 2.69 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|