C18H27N5O6 — CID 171322569
formic acid;3-(2-hydroxyethyl)-8-(1H-imidazole-5-carbonyl)-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 171322569) has the molecular formula C18H27N5O6 and a molecular weight of 409.44 g/mol. Its IUPAC name is formic acid;3-(2-hydroxyethyl)-8-(1H-imidazole-5-carbonyl)-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | formic acid;3-(2-hydroxyethyl)-8-(1H-imidazole-5-carbonyl)-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 171322569 |
| Molecular Formula | C18H27N5O6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | formic acid;3-(2-hydroxyethyl)-8-(1H-imidazole-5-carbonyl)-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(C)CN1C(=O)N(CCO)C(=O)C12CCN(C(=O)c1cnc[nH]1)CC2.O=CO |
| InChI | InChI=1S/C17H25N5O4.CH2O2/c1-12(2)10-22-16(26)21(7-8-23)15(25)17(22)3-5-20(6-4-17)14(24)13-9-18-11-19-13;2-1-3/h9,11-12,23H,3-8,10H2,1-2H3,(H,18,19);1H,(H,2,3) |
| InChIKey | YYYUUGTUADVXLE-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 147.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|