C21H28N6O5 — CID 171322598
3-ethyl-8-(imidazo[1,2-b]pyridazine-3-carbonyl)-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione;formic acid (PubChem CID 171322598) has the molecular formula C21H28N6O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is 3-ethyl-8-(imidazo[1,2-b]pyridazine-3-carbonyl)-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione;formic acid.
| Compound Name | 3-ethyl-8-(imidazo[1,2-b]pyridazine-3-carbonyl)-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione;formic acid |
|---|---|
| PubChem CID | 171322598 |
| Molecular Formula | C21H28N6O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 3-ethyl-8-(imidazo[1,2-b]pyridazine-3-carbonyl)-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione;formic acid |
| SMILES | CCN1C(=O)N(CC(C)C)C2(CCN(C(=O)c3cnc4cccnn34)CC2)C1=O.O=CO |
| InChI | InChI=1S/C20H26N6O3.CH2O2/c1-4-24-18(28)20(25(19(24)29)13-14(2)3)7-10-23(11-8-20)17(27)15-12-21-16-6-5-9-22-26(15)16;2-1-3/h5-6,9,12,14H,4,7-8,10-11,13H2,1-3H3;1H,(H,2,3) |
| InChIKey | RMAYGDVALXDCJB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|