C19H17N3S — CID 171323948
4-phenyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carbonitrile (PubChem CID 171323948) has the molecular formula C19H17N3S and a molecular weight of 319.43 g/mol. Its IUPAC name is 4-phenyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carbonitrile.
| Compound Name | 4-phenyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 171323948 |
| Molecular Formula | C19H17N3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 4-phenyl-1-thieno[3,2-c]pyridin-4-ylpiperidine-4-carbonitrile |
| SMILES | N#CC1(c2ccccc2)CCN(c2nccc3sccc23)CC1 |
| InChI | InChI=1S/C19H17N3S/c20-14-19(15-4-2-1-3-5-15)8-11-22(12-9-19)18-16-7-13-23-17(16)6-10-21-18/h1-7,10,13H,8-9,11-12H2 |
| InChIKey | SKQMPSXXCYUXNK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |