C21H20ClN5OS — CID 171324373
[2-[5-(4-chlorophenyl)pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-methyl-1,3-thiazol-4-yl)methanone (PubChem CID 171324373) has the molecular formula C21H20ClN5OS and a molecular weight of 425.95 g/mol. Its IUPAC name is [2-[5-(4-chlorophenyl)pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-methyl-1,3-thiazol-4-yl)methanone.
| Compound Name | [2-[5-(4-chlorophenyl)pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-methyl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 171324373 |
| Molecular Formula | C21H20ClN5OS |
| Molecular Weight | 425.95 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | [2-[5-(4-chlorophenyl)pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-methyl-1,3-thiazol-4-yl)methanone |
| SMILES | Cc1nc(C(=O)N2CC3CN(c4cnc(-c5ccc(Cl)cc5)cn4)CC3C2)cs1 |
| InChI | InChI=1S/C21H20ClN5OS/c1-13-25-19(12-29-13)21(28)27-10-15-8-26(9-16(15)11-27)20-7-23-18(6-24-20)14-2-4-17(22)5-3-14/h2-7,12,15-16H,8-11H2,1H3 |
| InChIKey | FLTBPBDQZDTCSU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.95 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |