C21H20FN5OS — CID 146080695
[2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]-(2-pyrazin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methanone (PubChem CID 146080695) has the molecular formula C21H20FN5OS and a molecular weight of 409.49 g/mol. Its IUPAC name is [2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]-(2-pyrazin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methanone.
| Compound Name | [2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]-(2-pyrazin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methanone |
|---|---|
| PubChem CID | 146080695 |
| Molecular Formula | C21H20FN5OS |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | [2-(2-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]-(2-pyrazin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methanone |
| SMILES | Cc1nc(-c2ccccc2F)sc1C(=O)N1CC2CN(c3cnccn3)CC2C1 |
| InChI | InChI=1S/C21H20FN5OS/c1-13-19(29-20(25-13)16-4-2-3-5-17(16)22)21(28)27-11-14-9-26(10-15(14)12-27)18-8-23-6-7-24-18/h2-8,14-15H,9-12H2,1H3 |
| InChIKey | DNYKLYLNQSSLLR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |