C22H31Cl2N5O2 — CID 171325582
N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-(4-oxoquinazolin-3-yl)acetamide;dihydrochloride (PubChem CID 171325582) has the molecular formula C22H31Cl2N5O2 and a molecular weight of 468.43 g/mol. Its IUPAC name is N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-(4-oxoquinazolin-3-yl)acetamide;dihydrochloride.
| Compound Name | N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-(4-oxoquinazolin-3-yl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 171325582 |
| Molecular Formula | C22H31Cl2N5O2 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-(4-oxoquinazolin-3-yl)acetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Cn1cnc2ccccc2c1=O)NC[C@H]1[C@@H]2CNC[C@@H](C2)[C@@H]2CCCCN21 |
| InChI | InChI=1S/C22H29N5O2.2ClH/c28-21(13-26-14-25-18-6-2-1-5-17(18)22(26)29)24-12-20-16-9-15(10-23-11-16)19-7-3-4-8-27(19)20;;/h1-2,5-6,14-16,19-20,23H,3-4,7-13H2,(H,24,28);2*1H/t15-,16+,19+,20+;;/m1../s1 |
| InChIKey | GNBKLWGGEBZIEQ-DYJNJINUSA-N |
| XLogP | 1.82 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |