C18H30Cl2N4OS — CID 171325293
N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide;dihydrochloride (PubChem CID 171325293) has the molecular formula C18H30Cl2N4OS and a molecular weight of 421.44 g/mol. Its IUPAC name is N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide;dihydrochloride.
| Compound Name | N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 171325293 |
| Molecular Formula | C18H30Cl2N4OS |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide;dihydrochloride |
| SMILES | Cc1nc(CC(=O)NC[C@H]2[C@@H]3CNC[C@@H](C3)[C@@H]3CCCCN32)cs1.Cl.Cl |
| InChI | InChI=1S/C18H28N4OS.2ClH/c1-12-21-15(11-24-12)7-18(23)20-10-17-14-6-13(8-19-9-14)16-4-2-3-5-22(16)17;;/h11,13-14,16-17,19H,2-10H2,1H3,(H,20,23);2*1H/t13-,14+,16+,17+;;/m1../s1 |
| InChIKey | CSIYYUIMMZEFCZ-GMQBPZJWSA-N |
| XLogP | 2.42 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |