C18H30Cl2N4O2 — CID 171325858
N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide;dihydrochloride (PubChem CID 171325858) has the molecular formula C18H30Cl2N4O2 and a molecular weight of 405.37 g/mol. Its IUPAC name is N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide;dihydrochloride.
| Compound Name | N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 171325858 |
| Molecular Formula | C18H30Cl2N4O2 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide;dihydrochloride |
| SMILES | Cc1cc(CC(=O)NC[C@H]2[C@@H]3CNC[C@@H](C3)[C@@H]3CCCCN32)on1.Cl.Cl |
| InChI | InChI=1S/C18H28N4O2.2ClH/c1-12-6-15(24-21-12)8-18(23)20-11-17-14-7-13(9-19-10-14)16-4-2-3-5-22(16)17;;/h6,13-14,16-17,19H,2-5,7-11H2,1H3,(H,20,23);2*1H/t13-,14+,16+,17+;;/m1../s1 |
| InChIKey | GNLWCMKXHUFRGJ-GMQBPZJWSA-N |
| XLogP | 1.95 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |