C22H33Cl2N5O — CID 171325376
N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-(2-methyl-3H-benzimidazol-5-yl)acetamide;dihydrochloride (PubChem CID 171325376) has the molecular formula C22H33Cl2N5O and a molecular weight of 454.45 g/mol. Its IUPAC name is N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-(2-methyl-3H-benzimidazol-5-yl)acetamide;dihydrochloride.
| Compound Name | N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-(2-methyl-3H-benzimidazol-5-yl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 171325376 |
| Molecular Formula | C22H33Cl2N5O |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-(2-methyl-3H-benzimidazol-5-yl)acetamide;dihydrochloride |
| SMILES | Cc1nc2ccc(CC(=O)NC[C@H]3[C@@H]4CNC[C@@H](C4)[C@@H]4CCCCN43)cc2[nH]1.Cl.Cl |
| InChI | InChI=1S/C22H31N5O.2ClH/c1-14-25-18-6-5-15(8-19(18)26-14)9-22(28)24-13-21-17-10-16(11-23-12-17)20-4-2-3-7-27(20)21;;/h5-6,8,16-17,20-21,23H,2-4,7,9-13H2,1H3,(H,24,28)(H,25,26);2*1H/t16-,17+,20+,21+;;/m1../s1 |
| InChIKey | PECGFWQPSDCJMR-YPBPTEPASA-N |
| XLogP | 2.84 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |