C24H33Cl2N5O — CID 171325769
N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-methyl-4-phenylpyrimidine-5-carboxamide;dihydrochloride (PubChem CID 171325769) has the molecular formula C24H33Cl2N5O and a molecular weight of 478.47 g/mol. Its IUPAC name is N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-methyl-4-phenylpyrimidine-5-carboxamide;dihydrochloride.
| Compound Name | N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-methyl-4-phenylpyrimidine-5-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 171325769 |
| Molecular Formula | C24H33Cl2N5O |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-methyl-4-phenylpyrimidine-5-carboxamide;dihydrochloride |
| SMILES | Cc1ncc(C(=O)NC[C@H]2[C@@H]3CNC[C@@H](C3)[C@@H]3CCCCN32)c(-c2ccccc2)n1.Cl.Cl |
| InChI | InChI=1S/C24H31N5O.2ClH/c1-16-26-14-20(23(28-16)17-7-3-2-4-8-17)24(30)27-15-22-19-11-18(12-25-13-19)21-9-5-6-10-29(21)22;;/h2-4,7-8,14,18-19,21-22,25H,5-6,9-13,15H2,1H3,(H,27,30);2*1H/t18-,19+,21+,22+;;/m1../s1 |
| InChIKey | DJCSQLLMRJLVFD-CRKHJPKCSA-N |
| XLogP | 3.49 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |