C21H30Cl2N6O2 — CID 171324997
2,3-dimethyl-N-[[(1R,2S,8R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]imidazo[4,5-b]pyridine-7-carboxamide;dihydrochloride (PubChem CID 171324997) has the molecular formula C21H30Cl2N6O2 and a molecular weight of 469.42 g/mol. Its IUPAC name is 2,3-dimethyl-N-[[(1R,2S,8R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]imidazo[4,5-b]pyridine-7-carboxamide;dihydrochloride.
| Compound Name | 2,3-dimethyl-N-[[(1R,2S,8R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]imidazo[4,5-b]pyridine-7-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 171324997 |
| Molecular Formula | C21H30Cl2N6O2 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 2,3-dimethyl-N-[[(1R,2S,8R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]imidazo[4,5-b]pyridine-7-carboxamide;dihydrochloride |
| SMILES | Cc1nc2c(C(=O)NC[C@H]3[C@@H]4CNC[C@@H](C4)[C@@H]4CCCC(=O)N43)ccnc2n1C.Cl.Cl |
| InChI | InChI=1S/C21H28N6O2.2ClH/c1-12-25-19-15(6-7-23-20(19)26(12)2)21(29)24-11-17-14-8-13(9-22-10-14)16-4-3-5-18(28)27(16)17;;/h6-7,13-14,16-17,22H,3-5,8-11H2,1-2H3,(H,24,29);2*1H/t13-,14+,16+,17+;;/m1../s1 |
| InChIKey | XKLOSFXZOAANQN-GMQBPZJWSA-N |
| XLogP | 1.84 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |