C22H33N5O2 — CID 171915252
N-[[(1R,2S,8R,9S)-11-cyclopentyl-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-methyl-1H-imidazole-5-carboxamide (PubChem CID 171915252) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is N-[[(1R,2S,8R,9S)-11-cyclopentyl-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-methyl-1H-imidazole-5-carboxamide.
| Compound Name | N-[[(1R,2S,8R,9S)-11-cyclopentyl-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-methyl-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 171915252 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | N-[[(1R,2S,8R,9S)-11-cyclopentyl-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-methyl-1H-imidazole-5-carboxamide |
| SMILES | Cc1ncc(C(=O)NC[C@H]2[C@H]3C[C@H](CN(C4CCCC4)C3)[C@@H]3CCCC(=O)N32)[nH]1 |
| InChI | InChI=1S/C22H33N5O2/c1-14-23-10-18(25-14)22(29)24-11-20-16-9-15(19-7-4-8-21(28)27(19)20)12-26(13-16)17-5-2-3-6-17/h10,15-17,19-20H,2-9,11-13H2,1H3,(H,23,25)(H,24,29)/t15-,16+,19+,20+/m1/s1 |
| InChIKey | PQCZJDCKYQCSGJ-LPWQTFTOSA-N |
| XLogP | 2.09 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |