C20H26N4O4 — CID 169421320
N-[[(1R,2S,8R,9S)-11-(3-hydroxypyridine-2-carbonyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]acetamide (PubChem CID 169421320) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-[[(1R,2S,8R,9S)-11-(3-hydroxypyridine-2-carbonyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]acetamide.
| Compound Name | N-[[(1R,2S,8R,9S)-11-(3-hydroxypyridine-2-carbonyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]acetamide |
|---|---|
| PubChem CID | 169421320 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-[[(1R,2S,8R,9S)-11-(3-hydroxypyridine-2-carbonyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1[C@H]2C[C@H](CN(C(=O)c3ncccc3O)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C20H26N4O4/c1-12(25)22-9-16-14-8-13(15-4-2-6-18(27)24(15)16)10-23(11-14)20(28)19-17(26)5-3-7-21-19/h3,5,7,13-16,26H,2,4,6,8-11H2,1H3,(H,22,25)/t13-,14+,15+,16+/m1/s1 |
| InChIKey | NZESSJPLOADTOC-UGUYLWEFSA-N |
| XLogP | 0.76 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |