C24H31ClN4O2 — CID 169419720
N-[[(1R,2S,8R,9S)-11-[(5-chloro-3-methyl-1H-indol-2-yl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]acetamide (PubChem CID 169419720) has the molecular formula C24H31ClN4O2 and a molecular weight of 442.99 g/mol. Its IUPAC name is N-[[(1R,2S,8R,9S)-11-[(5-chloro-3-methyl-1H-indol-2-yl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]acetamide.
| Compound Name | N-[[(1R,2S,8R,9S)-11-[(5-chloro-3-methyl-1H-indol-2-yl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]acetamide |
|---|---|
| PubChem CID | 169419720 |
| Molecular Formula | C24H31ClN4O2 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | N-[[(1R,2S,8R,9S)-11-[(5-chloro-3-methyl-1H-indol-2-yl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1[C@H]2C[C@H](CN(Cc3[nH]c4ccc(Cl)cc4c3C)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C24H31ClN4O2/c1-14-19-9-18(25)6-7-20(19)27-21(14)13-28-11-16-8-17(12-28)23(10-26-15(2)30)29-22(16)4-3-5-24(29)31/h6-7,9,16-17,22-23,27H,3-5,8,10-13H2,1-2H3,(H,26,30)/t16-,17+,22+,23+/m1/s1 |
| InChIKey | ORISXQRGKZSFMN-IFOZNXLVSA-N |
| XLogP | 3.47 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|