C23H30F4N2O3 — CID 166598906
(1R,2S,8S,9S)-11-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid (PubChem CID 166598906) has the molecular formula C23H30F4N2O3 and a molecular weight of 458.50 g/mol. Its IUPAC name is (1R,2S,8S,9S)-11-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid.
| Compound Name | (1R,2S,8S,9S)-11-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid |
|---|---|
| PubChem CID | 166598906 |
| Molecular Formula | C23H30F4N2O3 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | (1R,2S,8S,9S)-11-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid |
| SMILES | CCC[C@H]1[C@H]2C[C@H](CN(Cc3cc(C(F)(F)F)ccc3F)C2)[C@@H]2CCCC(=O)N21.O=CO |
| InChI | InChI=1S/C22H28F4N2O.CH2O2/c1-2-4-19-15-9-16(20-5-3-6-21(29)28(19)20)13-27(12-15)11-14-10-17(22(24,25)26)7-8-18(14)23;2-1-3/h7-8,10,15-16,19-20H,2-6,9,11-13H2,1H3;1H,(H,2,3)/t15-,16+,19-,20-;/m0./s1 |
| InChIKey | AZFFCNFGNKKWJA-OOGURODHSA-N |
| XLogP | 4.55 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|