C22H28N6O3 — CID 163312845
(1R,2S,8S,9S)-11-[2-hydroxy-4-(tetrazol-1-yl)benzoyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 163312845) has the molecular formula C22H28N6O3 and a molecular weight of 424.51 g/mol. Its IUPAC name is (1R,2S,8S,9S)-11-[2-hydroxy-4-(tetrazol-1-yl)benzoyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-11-[2-hydroxy-4-(tetrazol-1-yl)benzoyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 163312845 |
| Molecular Formula | C22H28N6O3 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | (1R,2S,8S,9S)-11-[2-hydroxy-4-(tetrazol-1-yl)benzoyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | CCC[C@H]1[C@H]2C[C@H](CN(C(=O)c3ccc(-n4cnnn4)cc3O)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C22H28N6O3/c1-2-4-18-14-9-15(19-5-3-6-21(30)28(18)19)12-26(11-14)22(31)17-8-7-16(10-20(17)29)27-13-23-24-25-27/h7-8,10,13-15,18-19,29H,2-6,9,11-12H2,1H3/t14-,15+,18-,19-/m0/s1 |
| InChIKey | GQBKZLRDPJENJH-QXGSTGNESA-N |
| XLogP | 2.01 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |