C26H38N2O5 — CID 166598772
(1R,2S,8S,9S)-11-(2-butoxybenzoyl)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid (PubChem CID 166598772) has the molecular formula C26H38N2O5 and a molecular weight of 458.60 g/mol. Its IUPAC name is (1R,2S,8S,9S)-11-(2-butoxybenzoyl)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid.
| Compound Name | (1R,2S,8S,9S)-11-(2-butoxybenzoyl)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid |
|---|---|
| PubChem CID | 166598772 |
| Molecular Formula | C26H38N2O5 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | (1R,2S,8S,9S)-11-(2-butoxybenzoyl)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid |
| SMILES | CCCCOc1ccccc1C(=O)N1C[C@H]2C[C@@H](C1)[C@H](CCC)N1C(=O)CCC[C@@H]21.O=CO |
| InChI | InChI=1S/C25H36N2O3.CH2O2/c1-3-5-14-30-23-12-7-6-10-20(23)25(29)26-16-18-15-19(17-26)22-11-8-13-24(28)27(22)21(18)9-4-2;2-1-3/h6-7,10,12,18-19,21-22H,3-5,8-9,11,13-17H2,1-2H3;1H,(H,2,3)/t18-,19+,21-,22-;/m0./s1 |
| InChIKey | SRMQMHIVJLQDFH-CBLRCLRLSA-N |
| XLogP | 4.21 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|