C22H28F2N2O3 — CID 165428656
(1R,2S,8S,9S)-11-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 165428656) has the molecular formula C22H28F2N2O3 and a molecular weight of 406.47 g/mol. Its IUPAC name is (1R,2S,8S,9S)-11-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-11-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 165428656 |
| Molecular Formula | C22H28F2N2O3 |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | (1R,2S,8S,9S)-11-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | CCC[C@H]1[C@H]2C[C@H](CN(Cc3ccc4c(c3)OC(F)(F)O4)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C22H28F2N2O3/c1-2-4-17-15-10-16(18-5-3-6-21(27)26(17)18)13-25(12-15)11-14-7-8-19-20(9-14)29-22(23,24)28-19/h7-9,15-18H,2-6,10-13H2,1H3/t15-,16+,17-,18-/m0/s1 |
| InChIKey | UWXKBBHKOFHGPQ-MHORFTMASA-N |
| XLogP | 4.01 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |