C22H31F3N2O2 — CID 164699813
(1R,2S,8S,9S)-8-(3-methylbutyl)-11-[[5-(trifluoromethyl)furan-2-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 164699813) has the molecular formula C22H31F3N2O2 and a molecular weight of 412.50 g/mol. Its IUPAC name is (1R,2S,8S,9S)-8-(3-methylbutyl)-11-[[5-(trifluoromethyl)furan-2-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-8-(3-methylbutyl)-11-[[5-(trifluoromethyl)furan-2-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 164699813 |
| Molecular Formula | C22H31F3N2O2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | (1R,2S,8S,9S)-8-(3-methylbutyl)-11-[[5-(trifluoromethyl)furan-2-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | CC(C)CC[C@H]1[C@H]2C[C@H](CN(Cc3ccc(C(F)(F)F)o3)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C22H31F3N2O2/c1-14(2)6-8-19-16-10-15(18-4-3-5-21(28)27(18)19)11-26(12-16)13-17-7-9-20(29-17)22(23,24)25/h7,9,14-16,18-19H,3-6,8,10-13H2,1-2H3/t15-,16+,18+,19+/m1/s1 |
| InChIKey | MYOATCWXTMILRO-NEPXVJNWSA-N |
| XLogP | 4.94 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |