C20H31N3O2S — CID 164692103
(1R,2S,8S,9S)-11-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 164692103) has the molecular formula C20H31N3O2S and a molecular weight of 377.55 g/mol. Its IUPAC name is (1R,2S,8S,9S)-11-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-11-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 164692103 |
| Molecular Formula | C20H31N3O2S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | (1R,2S,8S,9S)-11-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | CC(C)CC[C@H]1[C@H]2C[C@H](CN(c3nc(CO)cs3)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C20H31N3O2S/c1-13(2)6-7-18-15-8-14(17-4-3-5-19(25)23(17)18)9-22(10-15)20-21-16(11-24)12-26-20/h12-15,17-18,24H,3-11H2,1-2H3/t14-,15+,17+,18+/m1/s1 |
| InChIKey | LNLAYKYTBXJAEQ-FZCLSBEQSA-N |
| XLogP | 3.28 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |