C26H38N2O5 — CID 166599429
formic acid;2-[4-[[(1R,2S,8S,9S)-8-(3-methylbutyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methyl]phenyl]acetic acid (PubChem CID 166599429) has the molecular formula C26H38N2O5 and a molecular weight of 458.60 g/mol. Its IUPAC name is formic acid;2-[4-[[(1R,2S,8S,9S)-8-(3-methylbutyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methyl]phenyl]acetic acid.
| Compound Name | formic acid;2-[4-[[(1R,2S,8S,9S)-8-(3-methylbutyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 166599429 |
| Molecular Formula | C26H38N2O5 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | formic acid;2-[4-[[(1R,2S,8S,9S)-8-(3-methylbutyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methyl]phenyl]acetic acid |
| SMILES | CC(C)CC[C@H]1[C@H]2C[C@H](CN(Cc3ccc(CC(=O)O)cc3)C2)[C@@H]2CCCC(=O)N21.O=CO |
| InChI | InChI=1S/C25H36N2O3.CH2O2/c1-17(2)6-11-23-21-13-20(22-4-3-5-24(28)27(22)23)15-26(16-21)14-19-9-7-18(8-10-19)12-25(29)30;2-1-3/h7-10,17,20-23H,3-6,11-16H2,1-2H3,(H,29,30);1H,(H,2,3)/t20-,21+,22+,23+;/m1./s1 |
| InChIKey | QNQACRMRLKZFCL-IXISARQWSA-N |
| XLogP | 3.65 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|