C23H36N4O4 — CID 171322005
(1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid (PubChem CID 171322005) has the molecular formula C23H36N4O4 and a molecular weight of 432.57 g/mol. Its IUPAC name is (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid.
| Compound Name | (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid |
|---|---|
| PubChem CID | 171322005 |
| Molecular Formula | C23H36N4O4 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid |
| SMILES | Cc1noc(CN2C[C@H]3C[C@@H](C2)[C@H](CC2CCCCC2)N2C(=O)CCC[C@@H]32)n1.O=CO |
| InChI | InChI=1S/C22H34N4O2.CH2O2/c1-15-23-21(28-24-15)14-25-12-17-11-18(13-25)20(10-16-6-3-2-4-7-16)26-19(17)8-5-9-22(26)27;2-1-3/h16-20H,2-14H2,1H3;1H,(H,2,3)/t17-,18+,19+,20+;/m1./s1 |
| InChIKey | BVUDQHRZLBUROV-TVHQMXCISA-N |
| XLogP | 3.25 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|