C25H39N3O4 — CID 166598803
(1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid (PubChem CID 166598803) has the molecular formula C25H39N3O4 and a molecular weight of 445.60 g/mol. Its IUPAC name is (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid.
| Compound Name | (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid |
|---|---|
| PubChem CID | 166598803 |
| Molecular Formula | C25H39N3O4 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.29 |
| IUPAC Name | (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one;formic acid |
| SMILES | Cc1noc(C)c1CN1C[C@H]2C[C@@H](C1)[C@H](CC1CCCCC1)N1C(=O)CCC[C@@H]21.O=CO |
| InChI | InChI=1S/C24H37N3O2.CH2O2/c1-16-21(17(2)29-25-16)15-26-13-19-12-20(14-26)23(11-18-7-4-3-5-8-18)27-22(19)9-6-10-24(27)28;2-1-3/h18-20,22-23H,3-15H2,1-2H3;1H,(H,2,3)/t19-,20+,22+,23+;/m1./s1 |
| InChIKey | PDKJZJMSOIKTFI-ATVHSZILSA-N |
| XLogP | 4.16 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|