C23H34N2O6 — CID 171707275
formic acid;(1R,2S,8R,9S)-8-(hydroxymethyl)-11-[[4-methoxy-3-(methoxymethyl)phenyl]methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 171707275) has the molecular formula C23H34N2O6 and a molecular weight of 434.53 g/mol. Its IUPAC name is formic acid;(1R,2S,8R,9S)-8-(hydroxymethyl)-11-[[4-methoxy-3-(methoxymethyl)phenyl]methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | formic acid;(1R,2S,8R,9S)-8-(hydroxymethyl)-11-[[4-methoxy-3-(methoxymethyl)phenyl]methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 171707275 |
| Molecular Formula | C23H34N2O6 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | formic acid;(1R,2S,8R,9S)-8-(hydroxymethyl)-11-[[4-methoxy-3-(methoxymethyl)phenyl]methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | COCc1cc(CN2C[C@H]3C[C@@H](C2)[C@H](CO)N2C(=O)CCC[C@@H]32)ccc1OC.O=CO |
| InChI | InChI=1S/C22H32N2O4.CH2O2/c1-27-14-18-8-15(6-7-21(18)28-2)10-23-11-16-9-17(12-23)20(13-25)24-19(16)4-3-5-22(24)26;2-1-3/h6-8,16-17,19-20,25H,3-5,9-14H2,1-2H3;1H,(H,2,3)/t16-,17+,19+,20+;/m1./s1 |
| InChIKey | SJWWRJYKHRIDIS-LRSPBMBHSA-N |
| XLogP | 1.74 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|