C21H28N4O4 — CID 169420339
methyl 2-[(1R,2S,8R,9S)-8-(acetamidomethyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-3-carboxylate (PubChem CID 169420339) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is methyl 2-[(1R,2S,8R,9S)-8-(acetamidomethyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-3-carboxylate.
| Compound Name | methyl 2-[(1R,2S,8R,9S)-8-(acetamidomethyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 169420339 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | methyl 2-[(1R,2S,8R,9S)-8-(acetamidomethyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1N1C[C@H]2C[C@@H](C1)[C@H](CNC(C)=O)N1C(=O)CCC[C@@H]21 |
| InChI | InChI=1S/C21H28N4O4/c1-13(26)23-10-18-15-9-14(17-6-3-7-19(27)25(17)18)11-24(12-15)20-16(21(28)29-2)5-4-8-22-20/h4-5,8,14-15,17-18H,3,6-7,9-12H2,1-2H3,(H,23,26)/t14-,15+,17+,18+/m1/s1 |
| InChIKey | YLMRJDBIFYYAOC-FZCLSBEQSA-N |
| XLogP | 1.21 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |