C22H26N4O4 — CID 171914484
(1R,2S,8R,9S)-8-(2,5-dihydropyrrole-1-carbonyl)-11-(3-hydroxypyridine-2-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 171914484) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is (1R,2S,8R,9S)-8-(2,5-dihydropyrrole-1-carbonyl)-11-(3-hydroxypyridine-2-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8R,9S)-8-(2,5-dihydropyrrole-1-carbonyl)-11-(3-hydroxypyridine-2-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 171914484 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | (1R,2S,8R,9S)-8-(2,5-dihydropyrrole-1-carbonyl)-11-(3-hydroxypyridine-2-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | O=C(c1ncccc1O)N1C[C@H]2C[C@@H](C1)[C@H](C(=O)N1CC=CC1)N1C(=O)CCC[C@@H]21 |
| InChI | InChI=1S/C22H26N4O4/c27-17-6-4-8-23-19(17)21(29)25-12-14-11-15(13-25)20(22(30)24-9-1-2-10-24)26-16(14)5-3-7-18(26)28/h1-2,4,6,8,14-16,20,27H,3,5,7,9-13H2/t14-,15+,16+,20-/m1/s1 |
| InChIKey | UDZCZWAVNANWNI-NARAOEGZSA-N |
| XLogP | 1.03 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|