C21H24N6O2 — CID 171387930
3-[(1R,2S,8R,9S)-8-(2,5-dihydropyrrole-1-carbonyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrazine-2-carbonitrile (PubChem CID 171387930) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-[(1R,2S,8R,9S)-8-(2,5-dihydropyrrole-1-carbonyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrazine-2-carbonitrile.
| Compound Name | 3-[(1R,2S,8R,9S)-8-(2,5-dihydropyrrole-1-carbonyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 171387930 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 3-[(1R,2S,8R,9S)-8-(2,5-dihydropyrrole-1-carbonyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1N1C[C@H]2C[C@@H](C1)[C@H](C(=O)N1CC=CC1)N1C(=O)CCC[C@@H]21 |
| InChI | InChI=1S/C21H24N6O2/c22-11-16-20(24-7-6-23-16)26-12-14-10-15(13-26)19(21(29)25-8-1-2-9-25)27-17(14)4-3-5-18(27)28/h1-2,6-7,14-15,17,19H,3-5,8-10,12-13H2/t14-,15+,17+,19-/m1/s1 |
| InChIKey | MNYYJSHIWYFJLE-WXSAJPJJSA-N |
| XLogP | 0.95 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|