C22H28Cl2N4O3 — CID 171325861
5-hydroxy-N-[[(1R,2S,8R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]isoquinoline-6-carboxamide;dihydrochloride (PubChem CID 171325861) has the molecular formula C22H28Cl2N4O3 and a molecular weight of 467.40 g/mol. Its IUPAC name is 5-hydroxy-N-[[(1R,2S,8R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]isoquinoline-6-carboxamide;dihydrochloride.
| Compound Name | 5-hydroxy-N-[[(1R,2S,8R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]isoquinoline-6-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 171325861 |
| Molecular Formula | C22H28Cl2N4O3 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 5-hydroxy-N-[[(1R,2S,8R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]isoquinoline-6-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NC[C@H]1[C@@H]2CNC[C@@H](C2)[C@@H]2CCCC(=O)N21)c1ccc2cnccc2c1O |
| InChI | InChI=1S/C22H26N4O3.2ClH/c27-20-3-1-2-18-14-8-15(11-24-10-14)19(26(18)20)12-25-22(29)17-5-4-13-9-23-7-6-16(13)21(17)28;;/h4-7,9,14-15,18-19,24,28H,1-3,8,10-12H2,(H,25,29);2*1H/t14-,15+,18+,19+;;/m1../s1 |
| InChIKey | SLCKIEUMDWMOQE-VDJBJVKQSA-N |
| XLogP | 2.50 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |