C22H31Cl2N5O2 — CID 171325832
3-(1H-benzimidazol-2-yl)-N-[[(1R,2S,8R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]propanamide;dihydrochloride (PubChem CID 171325832) has the molecular formula C22H31Cl2N5O2 and a molecular weight of 468.43 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-N-[[(1R,2S,8R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]propanamide;dihydrochloride.
| Compound Name | 3-(1H-benzimidazol-2-yl)-N-[[(1R,2S,8R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 171325832 |
| Molecular Formula | C22H31Cl2N5O2 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-N-[[(1R,2S,8R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]propanamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CCc1nc2ccccc2[nH]1)NC[C@H]1[C@@H]2CNC[C@@H](C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C22H29N5O2.2ClH/c28-21(9-8-20-25-16-4-1-2-5-17(16)26-20)24-13-19-15-10-14(11-23-12-15)18-6-3-7-22(29)27(18)19;;/h1-2,4-5,14-15,18-19,23H,3,6-13H2,(H,24,28)(H,25,26);2*1H/t14-,15+,18+,19+;;/m1../s1 |
| InChIKey | HAUCFRKOZQCIPV-VDJBJVKQSA-N |
| XLogP | 2.44 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |