C22H33Cl2N3O3 — CID 171325100
3-(1,3-benzodioxol-5-yl)-N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]propanamide;dihydrochloride (PubChem CID 171325100) has the molecular formula C22H33Cl2N3O3 and a molecular weight of 458.43 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]propanamide;dihydrochloride.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 171325100 |
| Molecular Formula | C22H33Cl2N3O3 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]propanamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CCc1ccc2c(c1)OCO2)NC[C@H]1[C@@H]2CNC[C@@H](C2)[C@@H]2CCCCN21 |
| InChI | InChI=1S/C22H31N3O3.2ClH/c26-22(7-5-15-4-6-20-21(9-15)28-14-27-20)24-13-19-17-10-16(11-23-12-17)18-3-1-2-8-25(18)19;;/h4,6,9,16-19,23H,1-3,5,7-8,10-14H2,(H,24,26);2*1H/t16-,17+,18+,19+;;/m1../s1 |
| InChIKey | FBKCZVSLPGKXLN-RDRAYZSKSA-N |
| XLogP | 2.77 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |