C19H25ClN4O2S — CID 171710319
3-(2-methyl-1,3-thiazol-4-yl)-N-[[(1R,8R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]propanamide;hydrochloride (PubChem CID 171710319) has the molecular formula C19H25ClN4O2S and a molecular weight of 408.96 g/mol. Its IUPAC name is 3-(2-methyl-1,3-thiazol-4-yl)-N-[[(1R,8R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]propanamide;hydrochloride.
| Compound Name | 3-(2-methyl-1,3-thiazol-4-yl)-N-[[(1R,8R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 171710319 |
| Molecular Formula | C19H25ClN4O2S |
| Molecular Weight | 408.96 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 3-(2-methyl-1,3-thiazol-4-yl)-N-[[(1R,8R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]propanamide;hydrochloride |
| SMILES | Cc1nc(CCC(=O)NC[C@H]2[C@@H]3CNC[C@@H](C3)c3cccc(=O)n32)cs1.Cl |
| InChI | InChI=1S/C19H24N4O2S.ClH/c1-12-22-15(11-26-12)5-6-18(24)21-10-17-14-7-13(8-20-9-14)16-3-2-4-19(25)23(16)17;/h2-4,11,13-14,17,20H,5-10H2,1H3,(H,21,24);1H/t13-,14+,17+;/m1./s1 |
| InChIKey | MRWOYDONZYTVHX-RECIXLKMSA-N |
| XLogP | 2.03 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.96 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |