C22H31Cl2N5O2 — CID 171325197
N-[[(1R,8R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]-3-(4,5,6,7-tetrahydro-1H-indazol-3-yl)propanamide;dihydrochloride (PubChem CID 171325197) has the molecular formula C22H31Cl2N5O2 and a molecular weight of 468.43 g/mol. Its IUPAC name is N-[[(1R,8R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]-3-(4,5,6,7-tetrahydro-1H-indazol-3-yl)propanamide;dihydrochloride.
| Compound Name | N-[[(1R,8R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]-3-(4,5,6,7-tetrahydro-1H-indazol-3-yl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 171325197 |
| Molecular Formula | C22H31Cl2N5O2 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | N-[[(1R,8R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]-3-(4,5,6,7-tetrahydro-1H-indazol-3-yl)propanamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CCc1n[nH]c2c1CCCC2)NC[C@H]1[C@@H]2CNC[C@@H](C2)c2cccc(=O)n21 |
| InChI | InChI=1S/C22H29N5O2.2ClH/c28-21(9-8-18-16-4-1-2-5-17(16)25-26-18)24-13-20-15-10-14(11-23-12-15)19-6-3-7-22(29)27(19)20;;/h3,6-7,14-15,20,23H,1-2,4-5,8-13H2,(H,24,28)(H,25,26);2*1H/t14-,15+,20+;;/m1../s1 |
| InChIKey | CYDYCSFLUIIEBJ-DKJGWJINSA-N |
| XLogP | 2.29 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |