C19H23ClN4O3 — CID 171711480
(1R,8R,9S)-N-[(6-methoxy-3-pyridinyl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide;hydrochloride (PubChem CID 171711480) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is (1R,8R,9S)-N-[(6-methoxy-3-pyridinyl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide;hydrochloride.
| Compound Name | (1R,8R,9S)-N-[(6-methoxy-3-pyridinyl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 171711480 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (1R,8R,9S)-N-[(6-methoxy-3-pyridinyl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide;hydrochloride |
| SMILES | COc1ccc(CNC(=O)[C@H]2[C@@H]3CNC[C@@H](C3)c3cccc(=O)n32)cn1.Cl |
| InChI | InChI=1S/C19H22N4O3.ClH/c1-26-16-6-5-12(8-21-16)9-22-19(25)18-14-7-13(10-20-11-14)15-3-2-4-17(24)23(15)18;/h2-6,8,13-14,18,20H,7,9-11H2,1H3,(H,22,25);1H/t13-,14+,18-;/m1./s1 |
| InChIKey | PGYSIURSJPPASG-BZEWFBLPSA-N |
| XLogP | 1.24 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |