C21H21N5O2S — CID 171909610
(1R,8R,9S)-6-oxo-11-pyrimidin-2-yl-N-(thiophen-3-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide (PubChem CID 171909610) has the molecular formula C21H21N5O2S and a molecular weight of 407.50 g/mol. Its IUPAC name is (1R,8R,9S)-6-oxo-11-pyrimidin-2-yl-N-(thiophen-3-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide.
| Compound Name | (1R,8R,9S)-6-oxo-11-pyrimidin-2-yl-N-(thiophen-3-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide |
|---|---|
| PubChem CID | 171909610 |
| Molecular Formula | C21H21N5O2S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (1R,8R,9S)-6-oxo-11-pyrimidin-2-yl-N-(thiophen-3-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-8-carboxamide |
| SMILES | O=C(NCc1ccsc1)[C@H]1[C@H]2C[C@H](CN(c3ncccn3)C2)c2cccc(=O)n21 |
| InChI | InChI=1S/C21H21N5O2S/c27-18-4-1-3-17-15-9-16(12-25(11-15)21-22-6-2-7-23-21)19(26(17)18)20(28)24-10-14-5-8-29-13-14/h1-8,13,15-16,19H,9-12H2,(H,24,28)/t15-,16+,19-/m1/s1 |
| InChIKey | KPZSMCYIYXJZKE-JTDSTZFVSA-N |
| XLogP | 2.18 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |