C20H30Cl2N4O3 — CID 171326285
2,6-diamino-N-[1-[(4-methoxynaphthalen-2-yl)amino]-1-oxopropan-2-yl]hexanamide;dihydrochloride (PubChem CID 171326285) has the molecular formula C20H30Cl2N4O3 and a molecular weight of 445.39 g/mol. Its IUPAC name is 2,6-diamino-N-[1-[(4-methoxynaphthalen-2-yl)amino]-1-oxopropan-2-yl]hexanamide;dihydrochloride.
| Compound Name | 2,6-diamino-N-[1-[(4-methoxynaphthalen-2-yl)amino]-1-oxopropan-2-yl]hexanamide;dihydrochloride |
|---|---|
| PubChem CID | 171326285 |
| Molecular Formula | C20H30Cl2N4O3 |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 2,6-diamino-N-[1-[(4-methoxynaphthalen-2-yl)amino]-1-oxopropan-2-yl]hexanamide;dihydrochloride |
| SMILES | COc1cc(NC(=O)C(C)NC(=O)C(N)CCCCN)cc2ccccc12.Cl.Cl |
| InChI | InChI=1S/C20H28N4O3.2ClH/c1-13(23-20(26)17(22)9-5-6-10-21)19(25)24-15-11-14-7-3-4-8-16(14)18(12-15)27-2;;/h3-4,7-8,11-13,17H,5-6,9-10,21-22H2,1-2H3,(H,23,26)(H,24,25);2*1H |
| InChIKey | GJOOJLYXFGXARX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|