C22H26N4O5 — CID 171329823
ethyl 2-amino-3-cyano-4-(4-propan-2-yloxyphenyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate;formic acid (PubChem CID 171329823) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is ethyl 2-amino-3-cyano-4-(4-propan-2-yloxyphenyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate;formic acid.
| Compound Name | ethyl 2-amino-3-cyano-4-(4-propan-2-yloxyphenyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate;formic acid |
|---|---|
| PubChem CID | 171329823 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | ethyl 2-amino-3-cyano-4-(4-propan-2-yloxyphenyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate;formic acid |
| SMILES | CCOC(=O)N1CCc2nc(N)c(C#N)c(-c3ccc(OC(C)C)cc3)c2C1.O=CO |
| InChI | InChI=1S/C21H24N4O3.CH2O2/c1-4-27-21(26)25-10-9-18-17(12-25)19(16(11-22)20(23)24-18)14-5-7-15(8-6-14)28-13(2)3;2-1-3/h5-8,13H,4,9-10,12H2,1-3H3,(H2,23,24);1H,(H,2,3) |
| InChIKey | UQUCWEDBQOUUSU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 138.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|