C16H19N5O2 — CID 12582714
ethyl 3-hydrazinyl-4-phenyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazine-6-carboxylate (PubChem CID 12582714) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is ethyl 3-hydrazinyl-4-phenyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazine-6-carboxylate.
| Compound Name | ethyl 3-hydrazinyl-4-phenyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazine-6-carboxylate |
|---|---|
| PubChem CID | 12582714 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | ethyl 3-hydrazinyl-4-phenyl-7,8-dihydro-5H-pyrido[4,3-c]pyridazine-6-carboxylate |
| SMILES | CCOC(=O)N1CCc2nnc(NN)c(-c3ccccc3)c2C1 |
| InChI | InChI=1S/C16H19N5O2/c1-2-23-16(22)21-9-8-13-12(10-21)14(15(18-17)20-19-13)11-6-4-3-5-7-11/h3-7H,2,8-10,17H2,1H3,(H,18,20) |
| InChIKey | QQNIWICCHXJLBI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|