C10H14O7 — CID 171337299
methyl 1-hydroxy-2,5,5-trimethoxy-4-oxocyclopent-2-ene-1-carboxylate (PubChem CID 171337299) has the molecular formula C10H14O7 and a molecular weight of 246.21 g/mol. Its IUPAC name is methyl 1-hydroxy-2,5,5-trimethoxy-4-oxocyclopent-2-ene-1-carboxylate.
| Compound Name | methyl 1-hydroxy-2,5,5-trimethoxy-4-oxocyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 171337299 |
| Molecular Formula | C10H14O7 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | methyl 1-hydroxy-2,5,5-trimethoxy-4-oxocyclopent-2-ene-1-carboxylate |
| SMILES | COC(=O)C1(O)C(OC)=CC(=O)C1(OC)OC |
| InChI | InChI=1S/C10H14O7/c1-14-7-5-6(11)10(16-3,17-4)9(7,13)8(12)15-2/h5,13H,1-4H3 |
| InChIKey | CNSRPKSSPDSLPK-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|