C22H29Cl2N5O — CID 171338612
3-methyl-N-[4-methyl-2-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-yl)quinolin-6-yl]butanamide;dihydrochloride (PubChem CID 171338612) has the molecular formula C22H29Cl2N5O and a molecular weight of 450.41 g/mol. Its IUPAC name is 3-methyl-N-[4-methyl-2-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-yl)quinolin-6-yl]butanamide;dihydrochloride.
| Compound Name | 3-methyl-N-[4-methyl-2-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-yl)quinolin-6-yl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 171338612 |
| Molecular Formula | C22H29Cl2N5O |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 3-methyl-N-[4-methyl-2-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-yl)quinolin-6-yl]butanamide;dihydrochloride |
| SMILES | Cc1cc(-c2cc3n(n2)CCCNC3)nc2ccc(NC(=O)CC(C)C)cc12.Cl.Cl |
| InChI | InChI=1S/C22H27N5O.2ClH/c1-14(2)9-22(28)24-16-5-6-19-18(11-16)15(3)10-20(25-19)21-12-17-13-23-7-4-8-27(17)26-21;;/h5-6,10-12,14,23H,4,7-9,13H2,1-3H3,(H,24,28);2*1H |
| InChIKey | URSNZUJMPHJOLS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |