C19H18N4O5S — CID 171339703
2-amino-4-(1,3-thiazol-5-yl)-6-(2,3,4-trimethoxyphenyl)pyridine-3-carbonitrile;formic acid (PubChem CID 171339703) has the molecular formula C19H18N4O5S and a molecular weight of 414.44 g/mol. Its IUPAC name is 2-amino-4-(1,3-thiazol-5-yl)-6-(2,3,4-trimethoxyphenyl)pyridine-3-carbonitrile;formic acid.
| Compound Name | 2-amino-4-(1,3-thiazol-5-yl)-6-(2,3,4-trimethoxyphenyl)pyridine-3-carbonitrile;formic acid |
|---|---|
| PubChem CID | 171339703 |
| Molecular Formula | C19H18N4O5S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 2-amino-4-(1,3-thiazol-5-yl)-6-(2,3,4-trimethoxyphenyl)pyridine-3-carbonitrile;formic acid |
| SMILES | COc1ccc(-c2cc(-c3cncs3)c(C#N)c(N)n2)c(OC)c1OC.O=CO |
| InChI | InChI=1S/C18H16N4O3S.CH2O2/c1-23-14-5-4-10(16(24-2)17(14)25-3)13-6-11(15-8-21-9-26-15)12(7-19)18(20)22-13;2-1-3/h4-6,8-9H,1-3H3,(H2,20,22);1H,(H,2,3) |
| InChIKey | PBVXFQHOPSLNTA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 140.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|