C21H19F3N2O4 — CID 171339709
formic acid;7-(2-oxopyrrolidin-1-yl)-4-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 171339709) has the molecular formula C21H19F3N2O4 and a molecular weight of 420.39 g/mol. Its IUPAC name is formic acid;7-(2-oxopyrrolidin-1-yl)-4-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | formic acid;7-(2-oxopyrrolidin-1-yl)-4-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 171339709 |
| Molecular Formula | C21H19F3N2O4 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | formic acid;7-(2-oxopyrrolidin-1-yl)-4-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CC(c2cccc(C(F)(F)F)c2)c2ccc(N3CCCC3=O)cc2N1.O=CO |
| InChI | InChI=1S/C20H17F3N2O2.CH2O2/c21-20(22,23)13-4-1-3-12(9-13)16-11-18(26)24-17-10-14(6-7-15(16)17)25-8-2-5-19(25)27;2-1-3/h1,3-4,6-7,9-10,16H,2,5,8,11H2,(H,24,26);1H,(H,2,3) |
| InChIKey | HKVVKXCJKQANBO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|