C19H26N6O5S — CID 171339936
formic acid;(1S,2R,4R)-7-(1-methyl-5-oxo-4H-1,2,4-triazole-3-carbonyl)-N-propyl-2-(1,3-thiazol-4-ylmethyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 171339936) has the molecular formula C19H26N6O5S and a molecular weight of 450.52 g/mol. Its IUPAC name is formic acid;(1S,2R,4R)-7-(1-methyl-5-oxo-4H-1,2,4-triazole-3-carbonyl)-N-propyl-2-(1,3-thiazol-4-ylmethyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | formic acid;(1S,2R,4R)-7-(1-methyl-5-oxo-4H-1,2,4-triazole-3-carbonyl)-N-propyl-2-(1,3-thiazol-4-ylmethyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 171339936 |
| Molecular Formula | C19H26N6O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | formic acid;(1S,2R,4R)-7-(1-methyl-5-oxo-4H-1,2,4-triazole-3-carbonyl)-N-propyl-2-(1,3-thiazol-4-ylmethyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CCCNC(=O)[C@@]1(Cc2cscn2)C[C@H]2CC[C@@H]1N2C(=O)c1nn(C)c(=O)[nH]1.O=CO |
| InChI | InChI=1S/C18H24N6O3S.CH2O2/c1-3-6-19-16(26)18(7-11-9-28-10-20-11)8-12-4-5-13(18)24(12)15(25)14-21-17(27)23(2)22-14;2-1-3/h9-10,12-13H,3-8H2,1-2H3,(H,19,26)(H,21,22,27);1H,(H,2,3)/t12-,13+,18+;/m1./s1 |
| InChIKey | VWBRIVFZIMFBBB-VYQPADQISA-N |
| XLogP | 0.40 |
| TPSA | 150.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|