C24H34N2O6 — CID 171340051
N-[(2,4-dimethylphenyl)methyl]-4-[3-(2-oxooxolan-3-yl)propanoylamino]cyclohexane-1-carboxamide;formic acid (PubChem CID 171340051) has the molecular formula C24H34N2O6 and a molecular weight of 446.54 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)methyl]-4-[3-(2-oxooxolan-3-yl)propanoylamino]cyclohexane-1-carboxamide;formic acid.
| Compound Name | N-[(2,4-dimethylphenyl)methyl]-4-[3-(2-oxooxolan-3-yl)propanoylamino]cyclohexane-1-carboxamide;formic acid |
|---|---|
| PubChem CID | 171340051 |
| Molecular Formula | C24H34N2O6 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | N-[(2,4-dimethylphenyl)methyl]-4-[3-(2-oxooxolan-3-yl)propanoylamino]cyclohexane-1-carboxamide;formic acid |
| SMILES | Cc1ccc(CNC(=O)C2CCC(NC(=O)CCC3CCOC3=O)CC2)c(C)c1.O=CO |
| InChI | InChI=1S/C23H32N2O4.CH2O2/c1-15-3-4-19(16(2)13-15)14-24-22(27)17-5-8-20(9-6-17)25-21(26)10-7-18-11-12-29-23(18)28;2-1-3/h3-4,13,17-18,20H,5-12,14H2,1-2H3,(H,24,27)(H,25,26);1H,(H,2,3) |
| InChIKey | DRLDKIFFZJXHHK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|