C20H27N3O2 — CID 171340298
ethyl 3-[2-(1-propylpiperidin-4-yl)-1H-benzimidazol-4-yl]prop-2-enoate (PubChem CID 171340298) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is ethyl 3-[2-(1-propylpiperidin-4-yl)-1H-benzimidazol-4-yl]prop-2-enoate.
| Compound Name | ethyl 3-[2-(1-propylpiperidin-4-yl)-1H-benzimidazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 171340298 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | ethyl 3-[2-(1-propylpiperidin-4-yl)-1H-benzimidazol-4-yl]prop-2-enoate |
| SMILES | CCCN1CCC(c2nc3c(C=CC(=O)OCC)cccc3[nH]2)CC1 |
| InChI | InChI=1S/C20H27N3O2/c1-3-12-23-13-10-16(11-14-23)20-21-17-7-5-6-15(19(17)22-20)8-9-18(24)25-4-2/h5-9,16H,3-4,10-14H2,1-2H3,(H,21,22) |
| InChIKey | JITDLDGTZHBHFK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|