C20H20N2O2 — CID 22464991
ethyl (E)-3-[2-(2-phenylethyl)-1H-benzimidazol-4-yl]prop-2-enoate (PubChem CID 22464991) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is ethyl (E)-3-[2-(2-phenylethyl)-1H-benzimidazol-4-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-(2-phenylethyl)-1H-benzimidazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 22464991 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | ethyl (E)-3-[2-(2-phenylethyl)-1H-benzimidazol-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cccc2[nH]c(CCc3ccccc3)nc12 |
| InChI | InChI=1S/C20H20N2O2/c1-2-24-19(23)14-12-16-9-6-10-17-20(16)22-18(21-17)13-11-15-7-4-3-5-8-15/h3-10,12,14H,2,11,13H2,1H3,(H,21,22)/b14-12+ |
| InChIKey | ABBWGDNQESHZOH-WYMLVPIESA-N |
| XLogP | 3.92 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|