C26H27N3O4S — CID 22465006
ethyl 3-(benzenesulfonamido)-3-[2-(2-phenylethyl)-1H-benzimidazol-4-yl]propanoate (PubChem CID 22465006) has the molecular formula C26H27N3O4S and a molecular weight of 477.59 g/mol. Its IUPAC name is ethyl 3-(benzenesulfonamido)-3-[2-(2-phenylethyl)-1H-benzimidazol-4-yl]propanoate.
| Compound Name | ethyl 3-(benzenesulfonamido)-3-[2-(2-phenylethyl)-1H-benzimidazol-4-yl]propanoate |
|---|---|
| PubChem CID | 22465006 |
| Molecular Formula | C26H27N3O4S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | ethyl 3-(benzenesulfonamido)-3-[2-(2-phenylethyl)-1H-benzimidazol-4-yl]propanoate |
| SMILES | CCOC(=O)CC(NS(=O)(=O)c1ccccc1)c1cccc2[nH]c(CCc3ccccc3)nc12 |
| InChI | InChI=1S/C26H27N3O4S/c1-2-33-25(30)18-23(29-34(31,32)20-12-7-4-8-13-20)21-14-9-15-22-26(21)28-24(27-22)17-16-19-10-5-3-6-11-19/h3-15,23,29H,2,16-18H2,1H3,(H,27,28) |
| InChIKey | UECWUWQECHMUAP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |