C18H17NO2 — CID 171344737
(9R)-15,16-dimethoxy-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,11,13,15-heptaene (PubChem CID 171344737) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is (9R)-15,16-dimethoxy-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,11,13,15-heptaene.
| Compound Name | (9R)-15,16-dimethoxy-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,11,13,15-heptaene |
|---|---|
| PubChem CID | 171344737 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (9R)-15,16-dimethoxy-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,11,13,15-heptaene |
| SMILES | COc1cc2c3c(c1OC)-c1ccccc1C[C@H]3NC=C2 |
| InChI | InChI=1S/C18H17NO2/c1-20-15-10-12-7-8-19-14-9-11-5-3-4-6-13(11)17(16(12)14)18(15)21-2/h3-8,10,14,19H,9H2,1-2H3/t14-/m1/s1 |
| InChIKey | PAIXCQIYNOBQIS-CQSZACIVSA-N |
| XLogP | 3.54 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |