C19H15N3O3 — CID 171346308
5-(3-methoxy-5-quinolin-4-yloxyphenyl)-3-methyl-1,2,4-oxadiazole (PubChem CID 171346308) has the molecular formula C19H15N3O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is 5-(3-methoxy-5-quinolin-4-yloxyphenyl)-3-methyl-1,2,4-oxadiazole.
| Compound Name | 5-(3-methoxy-5-quinolin-4-yloxyphenyl)-3-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 171346308 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 5-(3-methoxy-5-quinolin-4-yloxyphenyl)-3-methyl-1,2,4-oxadiazole |
| SMILES | COc1cc(Oc2ccnc3ccccc23)cc(-c2nc(C)no2)c1 |
| InChI | InChI=1S/C19H15N3O3/c1-12-21-19(25-22-12)13-9-14(23-2)11-15(10-13)24-18-7-8-20-17-6-4-3-5-16(17)18/h3-11H,1-2H3 |
| InChIKey | LCSWLXZYAHMDCY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 70.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |