C24H29NO5 — CID 171348657
(2S,3R,4R)-4-hydroxy-2-[(1E,3E,5S,6R)-6-hydroxy-3,5-dimethylhepta-1,3-dienyl]-8-(4-hydroxyphenyl)-3-methyl-2,3,4,6-tetrahydropyrano[3,2-c]pyridin-5-one (PubChem CID 171348657) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is (2S,3R,4R)-4-hydroxy-2-[(1E,3E,5S,6R)-6-hydroxy-3,5-dimethylhepta-1,3-dienyl]-8-(4-hydroxyphenyl)-3-methyl-2,3,4,6-tetrahydropyrano[3,2-c]pyridin-5-one.
| Compound Name | (2S,3R,4R)-4-hydroxy-2-[(1E,3E,5S,6R)-6-hydroxy-3,5-dimethylhepta-1,3-dienyl]-8-(4-hydroxyphenyl)-3-methyl-2,3,4,6-tetrahydropyrano[3,2-c]pyridin-5-one |
|---|---|
| PubChem CID | 171348657 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | (2S,3R,4R)-4-hydroxy-2-[(1E,3E,5S,6R)-6-hydroxy-3,5-dimethylhepta-1,3-dienyl]-8-(4-hydroxyphenyl)-3-methyl-2,3,4,6-tetrahydropyrano[3,2-c]pyridin-5-one |
| SMILES | CC(/C=C/[C@@H]1Oc2c(-c3ccc(O)cc3)c[nH]c(=O)c2[C@H](O)[C@H]1C)=C\[C@H](C)[C@@H](C)O |
| InChI | InChI=1S/C24H29NO5/c1-13(11-14(2)16(4)26)5-10-20-15(3)22(28)21-23(30-20)19(12-25-24(21)29)17-6-8-18(27)9-7-17/h5-12,14-16,20,22,26-28H,1-4H3,(H,25,29)/b10-5+,13-11+/t14-,15-,16+,20-,22+/m0/s1 |
| InChIKey | PNTKQLIVGUNLMU-MFKWUVIVSA-N |
| XLogP | 3.70 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|